C22H24N2O6S2 — CID 22092071
3-(benzenesulfonyl)-1,1-dioxo-N-[3-(2-oxopyrrolidin-1-yl)propyl]-2,3-dihydro-1-benzothiophene-4-carboxamide (PubChem CID 22092071) has the molecular formula C22H24N2O6S2 and a molecular weight of 476.58 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-1,1-dioxo-N-[3-(2-oxopyrrolidin-1-yl)propyl]-2,3-dihydro-1-benzothiophene-4-carboxamide.
| Compound Name | 3-(benzenesulfonyl)-1,1-dioxo-N-[3-(2-oxopyrrolidin-1-yl)propyl]-2,3-dihydro-1-benzothiophene-4-carboxamide |
|---|---|
| PubChem CID | 22092071 |
| Molecular Formula | C22H24N2O6S2 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | 3-(benzenesulfonyl)-1,1-dioxo-N-[3-(2-oxopyrrolidin-1-yl)propyl]-2,3-dihydro-1-benzothiophene-4-carboxamide |
| SMILES | O=C(NCCCN1CCCC1=O)c1cccc2c1C(S(=O)(=O)c1ccccc1)CS2(=O)=O |
| InChI | InChI=1S/C22H24N2O6S2/c25-20-11-5-13-24(20)14-6-12-23-22(26)17-9-4-10-18-21(17)19(15-31(18,27)28)32(29,30)16-7-2-1-3-8-16/h1-4,7-10,19H,5-6,11-15H2,(H,23,26) |
| InChIKey | VLOVKCCGMBKPEH-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|