About dichloro(dimethylsilylidene)hafnium;bis(2-methyl-4,6-di(propan-2-yl)-1H-inden-1-ide)
dichloro(dimethylsilylidene)hafnium;bis(2-methyl-4,6-di(propan-2-yl)-1H-inden-1-ide) (PubChem CID 173247752) has the molecular formula C34H48Cl2HfSi-2
and a molecular weight of 734.24 g/mol. Its IUPAC name is dichloro(dimethylsilylidene)hafnium;bis(2-methyl-4,6-di(propan-2-yl)-1H-inden-1-ide).
Molecular Properties
| Compound Name | dichloro(dimethylsilylidene)hafnium;bis(2-methyl-4,6-di(propan-2-yl)-1H-inden-1-ide) |
| PubChem CID | 173247752 |
| Molecular Formula | C34H48Cl2HfSi-2 |
| Molecular Weight | 734.24 g/mol |
| Exact Mass | 734.24 |
| IUPAC Name | dichloro(dimethylsilylidene)hafnium;bis(2-methyl-4,6-di(propan-2-yl)-1H-inden-1-ide) |
| SMILES | C[Si](C)=[Hf](Cl)Cl.Cc1cc2c(C(C)C)cc(C(C)C)cc2[cH-]1.Cc1cc2c(C(C)C)cc(C(C)C)cc2[cH-]1 |
| InChI | InChI=1S/2C16H21.C2H6Si.2ClH.Hf/c2*1-10(2)13-8-14-6-12(5)7-16(14)15(9-13)11(3)4;1-3-2;;;/h2*6-11H,1-5H3;1-2H3;2*1H;/q2*-1;;;;+2/p-2 |
| InChIKey | DVRGBIYVSGCGMC-UHFFFAOYSA-L |
| XLogP | 12.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 734.24 |
| LogP ≤ 5 | 12.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dichloro(dimethylsilylidene)hafnium;bis(2-methyl-4,6-di(propan-2-yl)-1H-inden-1-ide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloro(dimethylsilylidene)hafnium;bis(2-methyl-4,6-di(propan-2-yl)-1H-inden-1-ide)?
The IUPAC name of dichloro(dimethylsilylidene)hafnium;bis(2-methyl-4,6-di(propan-2-yl)-1H-inden-1-ide) (CID 173247752) is dichloro(dimethylsilylidene)hafnium;bis(2-methyl-4,6-di(propan-2-yl)-1H-inden-1-ide).
What is the SMILES notation for dichloro(dimethylsilylidene)hafnium;bis(2-methyl-4,6-di(propan-2-yl)-1H-inden-1-ide)?
The canonical SMILES for dichloro(dimethylsilylidene)hafnium;bis(2-methyl-4,6-di(propan-2-yl)-1H-inden-1-ide) is C[Si](C)=[Hf](Cl)Cl.Cc1cc2c(C(C)C)cc(C(C)C)cc2[cH-]1.Cc1cc2c(C(C)C)cc(C(C)C)cc2[cH-]1.
What is the InChIKey of dichloro(dimethylsilylidene)hafnium;bis(2-methyl-4,6-di(propan-2-yl)-1H-inden-1-ide)?
The InChIKey is DVRGBIYVSGCGMC-UHFFFAOYSA-L. The full InChI is InChI=1S/2C16H21.C2H6Si.2ClH.Hf/c2*1-10(2)13-8-14-6-12(5)7-16(14)15(9-13)11(3)4;1-3-2;;;/h2*6-11H,1-5H3;1-2H3;2*1H;/q2*-1;;;;+2/p-2.
What are the key properties of dichloro(dimethylsilylidene)hafnium;bis(2-methyl-4,6-di(propan-2-yl)-1H-inden-1-ide)?
dichloro(dimethylsilylidene)hafnium;bis(2-methyl-4,6-di(propan-2-yl)-1H-inden-1-ide) has a molecular weight of 734.24 g/mol, XLogP of 12.39, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichloro(dimethylsilylidene)hafnium;bis(2-methyl-4,6-di(propan-2-yl)-1H-inden-1-ide) is sourced from PubChem (CID 173247752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).