C28H40N2O4 — CID 173249762
butanedioic acid;bis(2-phenyl-N-prop-2-enylpropan-2-amine) (PubChem CID 173249762) has the molecular formula C28H40N2O4 and a molecular weight of 468.64 g/mol. Its IUPAC name is butanedioic acid;bis(2-phenyl-N-prop-2-enylpropan-2-amine).
| Compound Name | butanedioic acid;bis(2-phenyl-N-prop-2-enylpropan-2-amine) |
|---|---|
| PubChem CID | 173249762 |
| Molecular Formula | C28H40N2O4 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.30 |
| IUPAC Name | butanedioic acid;bis(2-phenyl-N-prop-2-enylpropan-2-amine) |
| SMILES | C=CCNC(C)(C)c1ccccc1.C=CCNC(C)(C)c1ccccc1.O=C(O)CCC(=O)O |
| InChI | InChI=1S/2C12H17N.C4H6O4/c2*1-4-10-13-12(2,3)11-8-6-5-7-9-11;5-3(6)1-2-4(7)8/h2*4-9,13H,1,10H2,2-3H3;1-2H2,(H,5,6)(H,7,8) |
| InChIKey | WZZCMXYERBPCTM-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|