C17H28N2S2 — CID 173385686
diethylcarbamodithioic acid;2-phenyl-N-prop-2-enylpropan-2-amine (PubChem CID 173385686) has the molecular formula C17H28N2S2 and a molecular weight of 324.56 g/mol. Its IUPAC name is diethylcarbamodithioic acid;2-phenyl-N-prop-2-enylpropan-2-amine.
| Compound Name | diethylcarbamodithioic acid;2-phenyl-N-prop-2-enylpropan-2-amine |
|---|---|
| PubChem CID | 173385686 |
| Molecular Formula | C17H28N2S2 |
| Molecular Weight | 324.56 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | diethylcarbamodithioic acid;2-phenyl-N-prop-2-enylpropan-2-amine |
| SMILES | C=CCNC(C)(C)c1ccccc1.CCN(CC)C(=S)S |
| InChI | InChI=1S/C12H17N.C5H11NS2/c1-4-10-13-12(2,3)11-8-6-5-7-9-11;1-3-6(4-2)5(7)8/h4-9,13H,1,10H2,2-3H3;3-4H2,1-2H3,(H,7,8) |
| InChIKey | VAWOSKXELBGELG-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.56 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|