C11H22N2S2 — CID 88674834
N-ethylprop-2-en-1-amine;ethyl(prop-2-enyl)carbamodithioic acid (PubChem CID 88674834) has the molecular formula C11H22N2S2 and a molecular weight of 246.44 g/mol. Its IUPAC name is N-ethylprop-2-en-1-amine;ethyl(prop-2-enyl)carbamodithioic acid.
| Compound Name | N-ethylprop-2-en-1-amine;ethyl(prop-2-enyl)carbamodithioic acid |
|---|---|
| PubChem CID | 88674834 |
| Molecular Formula | C11H22N2S2 |
| Molecular Weight | 246.44 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | N-ethylprop-2-en-1-amine;ethyl(prop-2-enyl)carbamodithioic acid |
| SMILES | C=CCN(CC)C(=S)S.C=CCNCC |
| InChI | InChI=1S/C6H11NS2.C5H11N/c1-3-5-7(4-2)6(8)9;1-3-5-6-4-2/h3H,1,4-5H2,2H3,(H,8,9);3,6H,1,4-5H2,2H3 |
| InChIKey | ZZUKRFMUHDFLHT-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.44 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|