C13H26N2OS — CID 86741157
N-prop-2-enylpropan-1-amine;prop-2-enyl(propyl)carbamothioic S-acid (PubChem CID 86741157) has the molecular formula C13H26N2OS and a molecular weight of 258.43 g/mol. Its IUPAC name is N-prop-2-enylpropan-1-amine;prop-2-enyl(propyl)carbamothioic S-acid.
| Compound Name | N-prop-2-enylpropan-1-amine;prop-2-enyl(propyl)carbamothioic S-acid |
|---|---|
| PubChem CID | 86741157 |
| Molecular Formula | C13H26N2OS |
| Molecular Weight | 258.43 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | N-prop-2-enylpropan-1-amine;prop-2-enyl(propyl)carbamothioic S-acid |
| SMILES | C=CCN(CCC)C(=O)S.C=CCNCCC |
| InChI | InChI=1S/C7H13NOS.C6H13N/c1-3-5-8(6-4-2)7(9)10;1-3-5-7-6-4-2/h3H,1,4-6H2,2H3,(H,9,10);3,7H,1,4-6H2,2H3 |
| InChIKey | IKTIDSDKOONEBP-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|