C24H39NO3 — CID 173250501
(8R,9R,10S,13R,14R)-17-[5-(hydroxyamino)penta-1,3-dienyl]-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,14-diol (PubChem CID 173250501) has the molecular formula C24H39NO3 and a molecular weight of 389.58 g/mol. Its IUPAC name is (8R,9R,10S,13R,14R)-17-[5-(hydroxyamino)penta-1,3-dienyl]-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,14-diol.
| Compound Name | (8R,9R,10S,13R,14R)-17-[5-(hydroxyamino)penta-1,3-dienyl]-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,14-diol |
|---|---|
| PubChem CID | 173250501 |
| Molecular Formula | C24H39NO3 |
| Molecular Weight | 389.58 g/mol |
| Exact Mass | 389.29 |
| IUPAC Name | (8R,9R,10S,13R,14R)-17-[5-(hydroxyamino)penta-1,3-dienyl]-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,14-diol |
| SMILES | C[C@]12CCC(O)CC1CC[C@@H]1[C@H]2CC[C@]2(C)C(C=CC=CCNO)CC[C@@]12O |
| InChI | InChI=1S/C24H39NO3/c1-22-12-10-19(26)16-18(22)7-8-21-20(22)11-13-23(2)17(9-14-24(21,23)27)6-4-3-5-15-25-28/h3-6,17-21,25-28H,7-16H2,1-2H3/t17?,18?,19?,20-,21-,22+,23-,24-/m1/s1 |
| InChIKey | LSMYOWRNWCLNSF-VLFVVSQHSA-N |
| XLogP | 4.21 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.58 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|