C22H37N3O2S — CID 176528017
methyl N-[(E)-[(3S,5R,8R,9S,10S,13R,14S,17S)-3,14-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]methylideneamino]carbamimidothioate (PubChem CID 176528017) has the molecular formula C22H37N3O2S and a molecular weight of 407.62 g/mol. Its IUPAC name is methyl N-[(E)-[(3S,5R,8R,9S,10S,13R,14S,17S)-3,14-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]methylideneamino]carbamimidothioate.
| Compound Name | methyl N-[(E)-[(3S,5R,8R,9S,10S,13R,14S,17S)-3,14-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 176528017 |
| Molecular Formula | C22H37N3O2S |
| Molecular Weight | 407.62 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | methyl N-[(E)-[(3S,5R,8R,9S,10S,13R,14S,17S)-3,14-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]methylideneamino]carbamimidothioate |
| SMILES | [H]/N=C(/N/N=C/[C@H]1CC[C@]2(O)[C@@H]3CC[C@@H]4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C)SC |
| InChI | InChI=1S/C22H37N3O2S/c1-20-9-7-16(26)12-14(20)4-5-18-17(20)8-10-21(2)15(6-11-22(18,21)27)13-24-25-19(23)28-3/h13-18,26-27H,4-12H2,1-3H3,(H2,23,25)/b24-13+/t14-,15-,16+,17+,18-,20+,21-,22+/m1/s1 |
| InChIKey | JEGMCZYJWJZWEE-SYACKNLOSA-N |
| XLogP | 3.99 |
| TPSA | 88.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.62 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|