C23H41N5O2 — CID 176524485
1-[(E)-[(8R,9R,10S,13R,14R)-3-(2-aminoethoxy)-14-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]methylideneamino]guanidine (PubChem CID 176524485) has the molecular formula C23H41N5O2 and a molecular weight of 419.61 g/mol. Its IUPAC name is 1-[(E)-[(8R,9R,10S,13R,14R)-3-(2-aminoethoxy)-14-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]methylideneamino]guanidine.
| Compound Name | 1-[(E)-[(8R,9R,10S,13R,14R)-3-(2-aminoethoxy)-14-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 176524485 |
| Molecular Formula | C23H41N5O2 |
| Molecular Weight | 419.61 g/mol |
| Exact Mass | 419.33 |
| IUPAC Name | 1-[(E)-[(8R,9R,10S,13R,14R)-3-(2-aminoethoxy)-14-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]methylideneamino]guanidine |
| SMILES | [H]/N=C(\N)N/N=C/C1CC[C@@]2(O)[C@@H]3CCC4CC(OCCN)CC[C@]4(C)[C@@H]3CC[C@]12C |
| InChI | InChI=1S/C23H41N5O2/c1-21-8-6-17(30-12-11-24)13-15(21)3-4-19-18(21)7-9-22(2)16(5-10-23(19,22)29)14-27-28-20(25)26/h14-19,29H,3-13,24H2,1-2H3,(H4,25,26,28)/b27-14+/t15?,16?,17?,18-,19-,21+,22-,23-/m1/s1 |
| InChIKey | QIPXQUQPWLFLLF-WLXJESNDSA-N |
| XLogP | 2.57 |
| TPSA | 129.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.61 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|