C20H34N4O2 — CID 176525572
1-[[(8R,9R,10S,13R,14R)-3,14-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-ylidene]amino]guanidine (PubChem CID 176525572) has the molecular formula C20H34N4O2 and a molecular weight of 362.52 g/mol. Its IUPAC name is 1-[[(8R,9R,10S,13R,14R)-3,14-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-ylidene]amino]guanidine.
| Compound Name | 1-[[(8R,9R,10S,13R,14R)-3,14-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-ylidene]amino]guanidine |
|---|---|
| PubChem CID | 176525572 |
| Molecular Formula | C20H34N4O2 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.27 |
| IUPAC Name | 1-[[(8R,9R,10S,13R,14R)-3,14-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-ylidene]amino]guanidine |
| SMILES | [H]/N=C(\N)NN=C1CC[C@@]2(O)[C@@H]3CCC4CC(O)CC[C@]4(C)[C@@H]3CC[C@]12C |
| InChI | InChI=1S/C20H34N4O2/c1-18-8-5-13(25)11-12(18)3-4-15-14(18)6-9-19(2)16(23-24-17(21)22)7-10-20(15,19)26/h12-15,25-26H,3-11H2,1-2H3,(H4,21,22,24)/t12?,13?,14-,15-,18+,19-,20-/m1/s1 |
| InChIKey | UVLYJFLBIJUIEX-HPRQVFPHSA-N |
| XLogP | 2.34 |
| TPSA | 114.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|