C17H23N3O2 — CID 173252783
2-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-ylmethyl)piperidin-1-yl]propanedial (PubChem CID 173252783) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is 2-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-ylmethyl)piperidin-1-yl]propanedial.
| Compound Name | 2-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-ylmethyl)piperidin-1-yl]propanedial |
|---|---|
| PubChem CID | 173252783 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 2-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-ylmethyl)piperidin-1-yl]propanedial |
| SMILES | O=CC(C=O)N1CCCC(Cc2ccc3c(n2)NCCC3)C1 |
| InChI | InChI=1S/C17H23N3O2/c21-11-16(12-22)20-8-2-3-13(10-20)9-15-6-5-14-4-1-7-18-17(14)19-15/h5-6,11-13,16H,1-4,7-10H2,(H,18,19) |
| InChIKey | KWTUATIFPIMUIU-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|