About aminomethyl acetate;hydrate
aminomethyl acetate;hydrate (PubChem CID 173252999) has the molecular formula C3H9NO3
and a molecular weight of 107.11 g/mol. Its IUPAC name is aminomethyl acetate;hydrate.
Molecular Properties
| Compound Name | aminomethyl acetate;hydrate |
| PubChem CID | 173252999 |
| Molecular Formula | C3H9NO3 |
| Molecular Weight | 107.11 g/mol |
| Exact Mass | 107.06 |
| IUPAC Name | aminomethyl acetate;hydrate |
| SMILES | CC(=O)OCN.O |
| InChI | InChI=1S/C3H7NO2.H2O/c1-3(5)6-2-4;/h2,4H2,1H3;1H2 |
| InChIKey | HHJBJALZOUFWGP-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 83.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 107.11 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze aminomethyl acetate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aminomethyl acetate;hydrate?
The IUPAC name of aminomethyl acetate;hydrate (CID 173252999) is aminomethyl acetate;hydrate.
What is the SMILES notation for aminomethyl acetate;hydrate?
The canonical SMILES for aminomethyl acetate;hydrate is CC(=O)OCN.O.
What is the InChIKey of aminomethyl acetate;hydrate?
The InChIKey is HHJBJALZOUFWGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO2.H2O/c1-3(5)6-2-4;/h2,4H2,1H3;1H2.
What are the key properties of aminomethyl acetate;hydrate?
aminomethyl acetate;hydrate has a molecular weight of 107.11 g/mol, XLogP of -1.36, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for aminomethyl acetate;hydrate is sourced from PubChem (CID 173252999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).