About aminomethyl acetate;dihydrochloride
aminomethyl acetate;dihydrochloride (PubChem CID 175752598) has the molecular formula C3H9Cl2NO2
and a molecular weight of 162.02 g/mol. Its IUPAC name is aminomethyl acetate;dihydrochloride.
Molecular Properties
| Compound Name | aminomethyl acetate;dihydrochloride |
| PubChem CID | 175752598 |
| Molecular Formula | C3H9Cl2NO2 |
| Molecular Weight | 162.02 g/mol |
| Exact Mass | 161.00 |
| IUPAC Name | aminomethyl acetate;dihydrochloride |
| SMILES | CC(=O)OCN.Cl.Cl |
| InChI | InChI=1S/C3H7NO2.2ClH/c1-3(5)6-2-4;;/h2,4H2,1H3;2*1H |
| InChIKey | GLNQIUWSJKRASA-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.02 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze aminomethyl acetate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aminomethyl acetate;dihydrochloride?
The IUPAC name of aminomethyl acetate;dihydrochloride (CID 175752598) is aminomethyl acetate;dihydrochloride.
What is the SMILES notation for aminomethyl acetate;dihydrochloride?
The canonical SMILES for aminomethyl acetate;dihydrochloride is CC(=O)OCN.Cl.Cl.
What is the InChIKey of aminomethyl acetate;dihydrochloride?
The InChIKey is GLNQIUWSJKRASA-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO2.2ClH/c1-3(5)6-2-4;;/h2,4H2,1H3;2*1H.
What are the key properties of aminomethyl acetate;dihydrochloride?
aminomethyl acetate;dihydrochloride has a molecular weight of 162.02 g/mol, XLogP of 0.31, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for aminomethyl acetate;dihydrochloride is sourced from PubChem (CID 175752598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).