C7H14ClNO2 — CID 173253015
5-(ethylamino)pent-4-enoic acid;hydrochloride (PubChem CID 173253015) has the molecular formula C7H14ClNO2 and a molecular weight of 179.65 g/mol. Its IUPAC name is 5-(ethylamino)pent-4-enoic acid;hydrochloride.
| Compound Name | 5-(ethylamino)pent-4-enoic acid;hydrochloride |
|---|---|
| PubChem CID | 173253015 |
| Molecular Formula | C7H14ClNO2 |
| Molecular Weight | 179.65 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 5-(ethylamino)pent-4-enoic acid;hydrochloride |
| SMILES | CCNC=CCCC(=O)O.Cl |
| InChI | InChI=1S/C7H13NO2.ClH/c1-2-8-6-4-3-5-7(9)10;/h4,6,8H,2-3,5H2,1H3,(H,9,10);1H |
| InChIKey | VVPCKUIWIKMKRM-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.65 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |