C16H19Cl2N3O2 — CID 173255861
3-[2-[4-(2,5-dichlorophenyl)piperazin-1-yl]ethyl]pyrrolidine-2,5-dione (PubChem CID 173255861) has the molecular formula C16H19Cl2N3O2 and a molecular weight of 356.25 g/mol. Its IUPAC name is 3-[2-[4-(2,5-dichlorophenyl)piperazin-1-yl]ethyl]pyrrolidine-2,5-dione.
| Compound Name | 3-[2-[4-(2,5-dichlorophenyl)piperazin-1-yl]ethyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 173255861 |
| Molecular Formula | C16H19Cl2N3O2 |
| Molecular Weight | 356.25 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 3-[2-[4-(2,5-dichlorophenyl)piperazin-1-yl]ethyl]pyrrolidine-2,5-dione |
| SMILES | O=C1CC(CCN2CCN(c3cc(Cl)ccc3Cl)CC2)C(=O)N1 |
| InChI | InChI=1S/C16H19Cl2N3O2/c17-12-1-2-13(18)14(10-12)21-7-5-20(6-8-21)4-3-11-9-15(22)19-16(11)23/h1-2,10-11H,3-9H2,(H,19,22,23) |
| InChIKey | BXXPVEIODZAGMI-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.25 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|