C10H15NaO7S2 — CID 173257947
sodium;5-butoxysulfonyl-2-hydroxybenzenesulfonic acid;hydride (PubChem CID 173257947) has the molecular formula C10H15NaO7S2 and a molecular weight of 334.35 g/mol. Its IUPAC name is sodium;5-butoxysulfonyl-2-hydroxybenzenesulfonic acid;hydride.
| Compound Name | sodium;5-butoxysulfonyl-2-hydroxybenzenesulfonic acid;hydride |
|---|---|
| PubChem CID | 173257947 |
| Molecular Formula | C10H15NaO7S2 |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | sodium;5-butoxysulfonyl-2-hydroxybenzenesulfonic acid;hydride |
| SMILES | CCCCOS(=O)(=O)c1ccc(O)c(S(=O)(=O)O)c1.[H-].[Na+] |
| InChI | InChI=1S/C10H14O7S2.Na.H/c1-2-3-6-17-19(15,16)8-4-5-9(11)10(7-8)18(12,13)14;;/h4-5,7,11H,2-3,6H2,1H3,(H,12,13,14);;/q;+1;-1 |
| InChIKey | SGDXXLIYXWYLTL-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|