C11H15NaO8S2 — CID 173257570
sodium;4-butoxysulfonyl-2-sulfobenzoic acid;hydride (PubChem CID 173257570) has the molecular formula C11H15NaO8S2 and a molecular weight of 362.36 g/mol. Its IUPAC name is sodium;4-butoxysulfonyl-2-sulfobenzoic acid;hydride.
| Compound Name | sodium;4-butoxysulfonyl-2-sulfobenzoic acid;hydride |
|---|---|
| PubChem CID | 173257570 |
| Molecular Formula | C11H15NaO8S2 |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | sodium;4-butoxysulfonyl-2-sulfobenzoic acid;hydride |
| SMILES | CCCCOS(=O)(=O)c1ccc(C(=O)O)c(S(=O)(=O)O)c1.[H-].[Na+] |
| InChI | InChI=1S/C11H14O8S2.Na.H/c1-2-3-6-19-21(17,18)8-4-5-9(11(12)13)10(7-8)20(14,15)16;;/h4-5,7H,2-3,6H2,1H3,(H,12,13)(H,14,15,16);;/q;+1;-1 |
| InChIKey | WWRHUWPWMHWSFR-UHFFFAOYSA-N |
| XLogP | -1.75 |
| TPSA | 135.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|