About CID 173264197
CID 173264197 (PubChem CID 173264197) has the molecular formula C20H34NaO6S
and a molecular weight of 425.54 g/mol.
Molecular Properties
| Compound Name | CID 173264197 |
| PubChem CID | 173264197 |
| Molecular Formula | C20H34NaO6S |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | — |
| SMILES | CCCCCCCCC(C)(OCCOc1ccccc1)OOS(=O)(=O)CC.[Na] |
| InChI | InChI=1S/C20H34O6S.Na/c1-4-6-7-8-9-13-16-20(3,25-26-27(21,22)5-2)24-18-17-23-19-14-11-10-12-15-19;/h10-12,14-15H,4-9,13,16-18H2,1-3H3; |
| InChIKey | SHAMTICSHUAVRX-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze CID 173264197 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173264197?
The IUPAC name of CID 173264197 (CID 173264197) is not available.
What is the SMILES notation for CID 173264197?
The canonical SMILES for CID 173264197 is CCCCCCCCC(C)(OCCOc1ccccc1)OOS(=O)(=O)CC.[Na].
What is the InChIKey of CID 173264197?
The InChIKey is SHAMTICSHUAVRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H34O6S.Na/c1-4-6-7-8-9-13-16-20(3,25-26-27(21,22)5-2)24-18-17-23-19-14-11-10-12-15-19;/h10-12,14-15H,4-9,13,16-18H2,1-3H3;.
What are the key properties of CID 173264197?
CID 173264197 has a molecular weight of 425.54 g/mol, XLogP of 4.47, 16 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173264197 is sourced from PubChem (CID 173264197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).