C22H46O9Si — CID 173269064
3,3-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propyl-(oxan-2-yl)silane (PubChem CID 173269064) has the molecular formula C22H46O9Si and a molecular weight of 482.69 g/mol. Its IUPAC name is 3,3-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propyl-(oxan-2-yl)silane.
| Compound Name | 3,3-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propyl-(oxan-2-yl)silane |
|---|---|
| PubChem CID | 173269064 |
| Molecular Formula | C22H46O9Si |
| Molecular Weight | 482.69 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | 3,3-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propyl-(oxan-2-yl)silane |
| SMILES | COCCOCCOCCOC(CC[SiH2]C1CCCCO1)OCCOCCOCCOC |
| InChI | InChI=1S/C22H46O9Si/c1-23-8-10-25-12-14-27-16-18-29-21(6-20-32-22-5-3-4-7-31-22)30-19-17-28-15-13-26-11-9-24-2/h21-22H,3-20,32H2,1-2H3 |
| InChIKey | ZUKJAZGLKKQCDN-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.69 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|