About 2-(oxan-2-ylsilyl)ethyl 2-sulfanylacetate
2-(oxan-2-ylsilyl)ethyl 2-sulfanylacetate (PubChem CID 173483105) has the molecular formula C9H18O3SSi
and a molecular weight of 234.39 g/mol. Its IUPAC name is 2-(oxan-2-ylsilyl)ethyl 2-sulfanylacetate.
Molecular Properties
| Compound Name | 2-(oxan-2-ylsilyl)ethyl 2-sulfanylacetate |
| PubChem CID | 173483105 |
| Molecular Formula | C9H18O3SSi |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 2-(oxan-2-ylsilyl)ethyl 2-sulfanylacetate |
| SMILES | O=C(CS)OCC[SiH2]C1CCCCO1 |
| InChI | InChI=1S/C9H18O3SSi/c10-8(7-13)11-5-6-14-9-3-1-2-4-12-9/h9,13H,1-7,14H2 |
| InChIKey | WDLWZCSKBLDGAL-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(oxan-2-ylsilyl)ethyl 2-sulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxan-2-ylsilyl)ethyl 2-sulfanylacetate?
The IUPAC name of 2-(oxan-2-ylsilyl)ethyl 2-sulfanylacetate (CID 173483105) is 2-(oxan-2-ylsilyl)ethyl 2-sulfanylacetate.
What is the SMILES notation for 2-(oxan-2-ylsilyl)ethyl 2-sulfanylacetate?
The canonical SMILES for 2-(oxan-2-ylsilyl)ethyl 2-sulfanylacetate is O=C(CS)OCC[SiH2]C1CCCCO1.
What is the InChIKey of 2-(oxan-2-ylsilyl)ethyl 2-sulfanylacetate?
The InChIKey is WDLWZCSKBLDGAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O3SSi/c10-8(7-13)11-5-6-14-9-3-1-2-4-12-9/h9,13H,1-7,14H2.
What are the key properties of 2-(oxan-2-ylsilyl)ethyl 2-sulfanylacetate?
2-(oxan-2-ylsilyl)ethyl 2-sulfanylacetate has a molecular weight of 234.39 g/mol, XLogP of 0.57, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxan-2-ylsilyl)ethyl 2-sulfanylacetate is sourced from PubChem (CID 173483105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).