About oxan-2-ylsilylformic acid
oxan-2-ylsilylformic acid (PubChem CID 123628710) has the molecular formula C6H12O3Si
and a molecular weight of 160.24 g/mol. Its IUPAC name is oxan-2-ylsilylformic acid.
Molecular Properties
| Compound Name | oxan-2-ylsilylformic acid |
| PubChem CID | 123628710 |
| Molecular Formula | C6H12O3Si |
| Molecular Weight | 160.24 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | oxan-2-ylsilylformic acid |
| SMILES | O=C(O)[SiH2]C1CCCCO1 |
| InChI | InChI=1S/C6H12O3Si/c7-6(8)10-5-3-1-2-4-9-5/h5H,1-4,10H2,(H,7,8) |
| InChIKey | RXLBVMLOBZKSNT-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.24 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze oxan-2-ylsilylformic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxan-2-ylsilylformic acid?
The IUPAC name of oxan-2-ylsilylformic acid (CID 123628710) is oxan-2-ylsilylformic acid.
What is the SMILES notation for oxan-2-ylsilylformic acid?
The canonical SMILES for oxan-2-ylsilylformic acid is O=C(O)[SiH2]C1CCCCO1.
What is the InChIKey of oxan-2-ylsilylformic acid?
The InChIKey is RXLBVMLOBZKSNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O3Si/c7-6(8)10-5-3-1-2-4-9-5/h5H,1-4,10H2,(H,7,8).
What are the key properties of oxan-2-ylsilylformic acid?
oxan-2-ylsilylformic acid has a molecular weight of 160.24 g/mol, XLogP of 0.36, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for oxan-2-ylsilylformic acid is sourced from PubChem (CID 123628710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).