oxan-2-ylsilylformic acid

C6H12O3Si — CID 123628710

IUPACoxan-2-ylsilylformic acid
SMILESO=C(O)[SiH2]C1CCCCO1
InChIInChI=1S/C6H12O3Si/c7-6(8)10-5-3-1-2-4-9-5/h5H,1-4,10H2,(H,7,8)
InChIKeyRXLBVMLOBZKSNT-UHFFFAOYSA-N
MW160.24 g/mol
LogP0.36
Rot. Bonds2

About oxan-2-ylsilylformic acid

oxan-2-ylsilylformic acid (PubChem CID 123628710) has the molecular formula C6H12O3Si and a molecular weight of 160.24 g/mol. Its IUPAC name is oxan-2-ylsilylformic acid.

Molecular Properties

Compound Nameoxan-2-ylsilylformic acid
PubChem CID123628710
Molecular FormulaC6H12O3Si
Molecular Weight160.24 g/mol
Exact Mass160.06
IUPAC Nameoxan-2-ylsilylformic acid
SMILESO=C(O)[SiH2]C1CCCCO1
InChIInChI=1S/C6H12O3Si/c7-6(8)10-5-3-1-2-4-9-5/h5H,1-4,10H2,(H,7,8)
InChIKeyRXLBVMLOBZKSNT-UHFFFAOYSA-N
XLogP0.36
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500160.24
LogP ≤ 50.36
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze oxan-2-ylsilylformic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of oxan-2-ylsilylformic acid?
The IUPAC name of oxan-2-ylsilylformic acid (CID 123628710) is oxan-2-ylsilylformic acid.
What is the SMILES notation for oxan-2-ylsilylformic acid?
The canonical SMILES for oxan-2-ylsilylformic acid is O=C(O)[SiH2]C1CCCCO1.
What is the InChIKey of oxan-2-ylsilylformic acid?
The InChIKey is RXLBVMLOBZKSNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O3Si/c7-6(8)10-5-3-1-2-4-9-5/h5H,1-4,10H2,(H,7,8).
What are the key properties of oxan-2-ylsilylformic acid?
oxan-2-ylsilylformic acid has a molecular weight of 160.24 g/mol, XLogP of 0.36, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for oxan-2-ylsilylformic acid is sourced from PubChem (CID 123628710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).