About benzene;methyl(oxan-2-yl)silane
benzene;methyl(oxan-2-yl)silane (PubChem CID 174962664) has the molecular formula C12H20OSi
and a molecular weight of 208.38 g/mol. Its IUPAC name is benzene;methyl(oxan-2-yl)silane.
Molecular Properties
| Compound Name | benzene;methyl(oxan-2-yl)silane |
| PubChem CID | 174962664 |
| Molecular Formula | C12H20OSi |
| Molecular Weight | 208.38 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | benzene;methyl(oxan-2-yl)silane |
| SMILES | C[SiH2]C1CCCCO1.c1ccccc1 |
| InChI | InChI=1S/C6H14OSi.C6H6/c1-8-6-4-2-3-5-7-6;1-2-4-6-5-3-1/h6H,2-5,8H2,1H3;1-6H |
| InChIKey | WKSGYKYYAVRKEG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze benzene;methyl(oxan-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;methyl(oxan-2-yl)silane?
The IUPAC name of benzene;methyl(oxan-2-yl)silane (CID 174962664) is benzene;methyl(oxan-2-yl)silane.
What is the SMILES notation for benzene;methyl(oxan-2-yl)silane?
The canonical SMILES for benzene;methyl(oxan-2-yl)silane is C[SiH2]C1CCCCO1.c1ccccc1.
What is the InChIKey of benzene;methyl(oxan-2-yl)silane?
The InChIKey is WKSGYKYYAVRKEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14OSi.C6H6/c1-8-6-4-2-3-5-7-6;1-2-4-6-5-3-1/h6H,2-5,8H2,1H3;1-6H.
What are the key properties of benzene;methyl(oxan-2-yl)silane?
benzene;methyl(oxan-2-yl)silane has a molecular weight of 208.38 g/mol, XLogP of 2.42, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;methyl(oxan-2-yl)silane is sourced from PubChem (CID 174962664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).