About benzyl(oxan-2-yl)silane
benzyl(oxan-2-yl)silane (PubChem CID 123526004) has the molecular formula C12H18OSi
and a molecular weight of 206.36 g/mol. Its IUPAC name is benzyl(oxan-2-yl)silane.
Molecular Properties
| Compound Name | benzyl(oxan-2-yl)silane |
| PubChem CID | 123526004 |
| Molecular Formula | C12H18OSi |
| Molecular Weight | 206.36 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | benzyl(oxan-2-yl)silane |
| SMILES | c1ccc(C[SiH2]C2CCCCO2)cc1 |
| InChI | InChI=1S/C12H18OSi/c1-2-6-11(7-3-1)10-14-12-8-4-5-9-13-12/h1-3,6-7,12H,4-5,8-10,14H2 |
| InChIKey | VTBRBRUGTIFECK-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.36 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze benzyl(oxan-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl(oxan-2-yl)silane?
The IUPAC name of benzyl(oxan-2-yl)silane (CID 123526004) is benzyl(oxan-2-yl)silane.
What is the SMILES notation for benzyl(oxan-2-yl)silane?
The canonical SMILES for benzyl(oxan-2-yl)silane is c1ccc(C[SiH2]C2CCCCO2)cc1.
What is the InChIKey of benzyl(oxan-2-yl)silane?
The InChIKey is VTBRBRUGTIFECK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18OSi/c1-2-6-11(7-3-1)10-14-12-8-4-5-9-13-12/h1-3,6-7,12H,4-5,8-10,14H2.
What are the key properties of benzyl(oxan-2-yl)silane?
benzyl(oxan-2-yl)silane has a molecular weight of 206.36 g/mol, XLogP of 1.88, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl(oxan-2-yl)silane is sourced from PubChem (CID 123526004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).