C14H12N2O3 — CID 173270000
4-methyl-N-[2-[(E)-3-oxoprop-1-enyl]phenyl]-1,3-oxazole-2-carboxamide (PubChem CID 173270000) has the molecular formula C14H12N2O3 and a molecular weight of 256.26 g/mol. Its IUPAC name is 4-methyl-N-[2-[(E)-3-oxoprop-1-enyl]phenyl]-1,3-oxazole-2-carboxamide.
| Compound Name | 4-methyl-N-[2-[(E)-3-oxoprop-1-enyl]phenyl]-1,3-oxazole-2-carboxamide |
|---|---|
| PubChem CID | 173270000 |
| Molecular Formula | C14H12N2O3 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 4-methyl-N-[2-[(E)-3-oxoprop-1-enyl]phenyl]-1,3-oxazole-2-carboxamide |
| SMILES | Cc1coc(C(=O)Nc2ccccc2/C=C/C=O)n1 |
| InChI | InChI=1S/C14H12N2O3/c1-10-9-19-14(15-10)13(18)16-12-7-3-2-5-11(12)6-4-8-17/h2-9H,1H3,(H,16,18)/b6-4+ |
| InChIKey | HIIKELZFAPHFFY-GQCTYLIASA-N |
| XLogP | 2.45 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|