C36H62N10O — CID 173271603
1-(2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontan-5-yl)-1-prop-2-enylurea (PubChem CID 173271603) has the molecular formula C36H62N10O and a molecular weight of 650.96 g/mol. Its IUPAC name is 1-(2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontan-5-yl)-1-prop-2-enylurea.
| Compound Name | 1-(2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontan-5-yl)-1-prop-2-enylurea |
|---|---|
| PubChem CID | 173271603 |
| Molecular Formula | C36H62N10O |
| Molecular Weight | 650.96 g/mol |
| Exact Mass | 650.51 |
| IUPAC Name | 1-(2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontan-5-yl)-1-prop-2-enylurea |
| SMILES | C=CCN(C(N)=O)C1CCCC2C3NC4NC(NC5NC(NC6NC(NC(N3)C21)C1CCCCC61)C1CCCCC51)C1CCCCC41 |
| InChI | InChI=1S/C36H62N10O/c1-2-18-46(36(37)47)26-17-9-16-25-27(26)35-44-33-24-15-8-7-14-23(24)31(42-33)40-29-20-11-4-3-10-19(20)28(38-29)39-30-21-12-5-6-13-22(21)32(41-30)43-34(25)45-35/h2,19-35,38-45H,1,3-18H2,(H2,37,47) |
| InChIKey | RDZPEZQCAVVXST-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 142.57 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.96 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|