C10H18AsNO5S — CID 173272370
2-[4-(ethylarsanylamino)phenyl]ethanol;sulfuric acid (PubChem CID 173272370) has the molecular formula C10H18AsNO5S and a molecular weight of 339.25 g/mol. Its IUPAC name is 2-[4-(ethylarsanylamino)phenyl]ethanol;sulfuric acid.
| Compound Name | 2-[4-(ethylarsanylamino)phenyl]ethanol;sulfuric acid |
|---|---|
| PubChem CID | 173272370 |
| Molecular Formula | C10H18AsNO5S |
| Molecular Weight | 339.25 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | 2-[4-(ethylarsanylamino)phenyl]ethanol;sulfuric acid |
| SMILES | CC[AsH]Nc1ccc(CCO)cc1.O=S(=O)(O)O |
| InChI | InChI=1S/C10H16AsNO.H2O4S/c1-2-11-12-10-5-3-9(4-6-10)7-8-13;1-5(2,3)4/h3-6,11-13H,2,7-8H2,1H3;(H2,1,2,3,4) |
| InChIKey | UXSNKAJSPHEKOS-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.25 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|