C24H47FNO5S+ — CID 175503774
2-(4-fluorophenyl)ethanol;sulfuric acid;tetrabutylazanium (PubChem CID 175503774) has the molecular formula C24H47FNO5S+ and a molecular weight of 480.71 g/mol. Its IUPAC name is 2-(4-fluorophenyl)ethanol;sulfuric acid;tetrabutylazanium.
| Compound Name | 2-(4-fluorophenyl)ethanol;sulfuric acid;tetrabutylazanium |
|---|---|
| PubChem CID | 175503774 |
| Molecular Formula | C24H47FNO5S+ |
| Molecular Weight | 480.71 g/mol |
| Exact Mass | 480.32 |
| IUPAC Name | 2-(4-fluorophenyl)ethanol;sulfuric acid;tetrabutylazanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.O=S(=O)(O)O.OCCc1ccc(F)cc1 |
| InChI | InChI=1S/C16H36N.C8H9FO.H2O4S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;9-8-3-1-7(2-4-8)5-6-10;1-5(2,3)4/h5-16H2,1-4H3;1-4,10H,5-6H2;(H2,1,2,3,4)/q+1;; |
| InChIKey | JHTSIEISHPZJPP-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.71 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|