C22H41FNO3S+ — CID 88732741
diethyl-[4-(4-fluorophenyl)butyl]-heptylazanium;methanesulfonic acid (PubChem CID 88732741) has the molecular formula C22H41FNO3S+ and a molecular weight of 418.64 g/mol. Its IUPAC name is diethyl-[4-(4-fluorophenyl)butyl]-heptylazanium;methanesulfonic acid.
| Compound Name | diethyl-[4-(4-fluorophenyl)butyl]-heptylazanium;methanesulfonic acid |
|---|---|
| PubChem CID | 88732741 |
| Molecular Formula | C22H41FNO3S+ |
| Molecular Weight | 418.64 g/mol |
| Exact Mass | 418.28 |
| IUPAC Name | diethyl-[4-(4-fluorophenyl)butyl]-heptylazanium;methanesulfonic acid |
| SMILES | CCCCCCC[N+](CC)(CC)CCCCc1ccc(F)cc1.CS(=O)(=O)O |
| InChI | InChI=1S/C21H37FN.CH4O3S/c1-4-7-8-9-11-18-23(5-2,6-3)19-12-10-13-20-14-16-21(22)17-15-20;1-5(2,3)4/h14-17H,4-13,18-19H2,1-3H3;1H3,(H,2,3,4)/q+1; |
| InChIKey | LBFYYSVPNRLLTN-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.64 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|