About diethyl-heptyl-[4-(4-methylphenyl)butyl]azanium;1-methyl-4-methylsulfanylbenzene
diethyl-heptyl-[4-(4-methylphenyl)butyl]azanium;1-methyl-4-methylsulfanylbenzene (PubChem CID 176697815) has the molecular formula C30H50NS+
and a molecular weight of 456.80 g/mol. Its IUPAC name is diethyl-heptyl-[4-(4-methylphenyl)butyl]azanium;1-methyl-4-methylsulfanylbenzene.
Molecular Properties
| Compound Name | diethyl-heptyl-[4-(4-methylphenyl)butyl]azanium;1-methyl-4-methylsulfanylbenzene |
| PubChem CID | 176697815 |
| Molecular Formula | C30H50NS+ |
| Molecular Weight | 456.80 g/mol |
| Exact Mass | 456.37 |
| IUPAC Name | diethyl-heptyl-[4-(4-methylphenyl)butyl]azanium;1-methyl-4-methylsulfanylbenzene |
| SMILES | CCCCCCC[N+](CC)(CC)CCCCc1ccc(C)cc1.CSc1ccc(C)cc1 |
| InChI | InChI=1S/C22H40N.C8H10S/c1-5-8-9-10-12-19-23(6-2,7-3)20-13-11-14-22-17-15-21(4)16-18-22;1-7-3-5-8(9-2)6-4-7/h15-18H,5-14,19-20H2,1-4H3;3-6H,1-2H3/q+1; |
| InChIKey | JEPKWRJIPUSSPK-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.80 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze diethyl-heptyl-[4-(4-methylphenyl)butyl]azanium;1-methyl-4-methylsulfanylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl-heptyl-[4-(4-methylphenyl)butyl]azanium;1-methyl-4-methylsulfanylbenzene?
The IUPAC name of diethyl-heptyl-[4-(4-methylphenyl)butyl]azanium;1-methyl-4-methylsulfanylbenzene (CID 176697815) is diethyl-heptyl-[4-(4-methylphenyl)butyl]azanium;1-methyl-4-methylsulfanylbenzene.
What is the SMILES notation for diethyl-heptyl-[4-(4-methylphenyl)butyl]azanium;1-methyl-4-methylsulfanylbenzene?
The canonical SMILES for diethyl-heptyl-[4-(4-methylphenyl)butyl]azanium;1-methyl-4-methylsulfanylbenzene is CCCCCCC[N+](CC)(CC)CCCCc1ccc(C)cc1.CSc1ccc(C)cc1.
What is the InChIKey of diethyl-heptyl-[4-(4-methylphenyl)butyl]azanium;1-methyl-4-methylsulfanylbenzene?
The InChIKey is JEPKWRJIPUSSPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H40N.C8H10S/c1-5-8-9-10-12-19-23(6-2,7-3)20-13-11-14-22-17-15-21(4)16-18-22;1-7-3-5-8(9-2)6-4-7/h15-18H,5-14,19-20H2,1-4H3;3-6H,1-2H3/q+1;.
What are the key properties of diethyl-heptyl-[4-(4-methylphenyl)butyl]azanium;1-methyl-4-methylsulfanylbenzene?
diethyl-heptyl-[4-(4-methylphenyl)butyl]azanium;1-methyl-4-methylsulfanylbenzene has a molecular weight of 456.80 g/mol, XLogP of 8.86, 14 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl-heptyl-[4-(4-methylphenyl)butyl]azanium;1-methyl-4-methylsulfanylbenzene is sourced from PubChem (CID 176697815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).