C32H30Cl2N4O5 — CID 173273335
3-[4-[acetyl(methoxy)amino]phenyl]-N-[2-[2,4-dichloro-N-methyl-3-[(2-methylquinolin-8-yl)oxymethyl]anilino]-2-oxoethyl]prop-2-enamide (PubChem CID 173273335) has the molecular formula C32H30Cl2N4O5 and a molecular weight of 621.52 g/mol. Its IUPAC name is 3-[4-[acetyl(methoxy)amino]phenyl]-N-[2-[2,4-dichloro-N-methyl-3-[(2-methylquinolin-8-yl)oxymethyl]anilino]-2-oxoethyl]prop-2-enamide.
| Compound Name | 3-[4-[acetyl(methoxy)amino]phenyl]-N-[2-[2,4-dichloro-N-methyl-3-[(2-methylquinolin-8-yl)oxymethyl]anilino]-2-oxoethyl]prop-2-enamide |
|---|---|
| PubChem CID | 173273335 |
| Molecular Formula | C32H30Cl2N4O5 |
| Molecular Weight | 621.52 g/mol |
| Exact Mass | 620.16 |
| IUPAC Name | 3-[4-[acetyl(methoxy)amino]phenyl]-N-[2-[2,4-dichloro-N-methyl-3-[(2-methylquinolin-8-yl)oxymethyl]anilino]-2-oxoethyl]prop-2-enamide |
| SMILES | CON(C(C)=O)c1ccc(C=CC(=O)NCC(=O)N(C)c2ccc(Cl)c(COc3cccc4ccc(C)nc34)c2Cl)cc1 |
| InChI | InChI=1S/C32H30Cl2N4O5/c1-20-8-12-23-6-5-7-28(32(23)36-20)43-19-25-26(33)15-16-27(31(25)34)37(3)30(41)18-35-29(40)17-11-22-9-13-24(14-10-22)38(42-4)21(2)39/h5-17H,18-19H2,1-4H3,(H,35,40) |
| InChIKey | RQJUYOXYCPQMEV-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 101.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.52 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|