C33H33Cl2N5O4 — CID 70180411
3-[4-[acetyl(dimethylamino)amino]phenyl]-N-[2-[2,4-dichloro-N-methyl-3-[(2-methylquinolin-8-yl)oxymethyl]anilino]-2-oxoethyl]prop-2-enamide (PubChem CID 70180411) has the molecular formula C33H33Cl2N5O4 and a molecular weight of 634.56 g/mol. Its IUPAC name is 3-[4-[acetyl(dimethylamino)amino]phenyl]-N-[2-[2,4-dichloro-N-methyl-3-[(2-methylquinolin-8-yl)oxymethyl]anilino]-2-oxoethyl]prop-2-enamide.
| Compound Name | 3-[4-[acetyl(dimethylamino)amino]phenyl]-N-[2-[2,4-dichloro-N-methyl-3-[(2-methylquinolin-8-yl)oxymethyl]anilino]-2-oxoethyl]prop-2-enamide |
|---|---|
| PubChem CID | 70180411 |
| Molecular Formula | C33H33Cl2N5O4 |
| Molecular Weight | 634.56 g/mol |
| Exact Mass | 633.19 |
| IUPAC Name | 3-[4-[acetyl(dimethylamino)amino]phenyl]-N-[2-[2,4-dichloro-N-methyl-3-[(2-methylquinolin-8-yl)oxymethyl]anilino]-2-oxoethyl]prop-2-enamide |
| SMILES | CC(=O)N(c1ccc(C=CC(=O)NCC(=O)N(C)c2ccc(Cl)c(COc3cccc4ccc(C)nc34)c2Cl)cc1)N(C)C |
| InChI | InChI=1S/C33H33Cl2N5O4/c1-21-9-13-24-7-6-8-29(33(24)37-21)44-20-26-27(34)16-17-28(32(26)35)39(5)31(43)19-36-30(42)18-12-23-10-14-25(15-11-23)40(22(2)41)38(3)4/h6-18H,19-20H2,1-5H3,(H,36,42) |
| InChIKey | CAYZIANKMNQSRV-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.56 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|