C9H20NNa — CID 173274170
sodium;hydride;3,3,4,4-tetramethylcyclopentan-1-amine (PubChem CID 173274170) has the molecular formula C9H20NNa and a molecular weight of 165.26 g/mol. Its IUPAC name is sodium;hydride;3,3,4,4-tetramethylcyclopentan-1-amine.
| Compound Name | sodium;hydride;3,3,4,4-tetramethylcyclopentan-1-amine |
|---|---|
| PubChem CID | 173274170 |
| Molecular Formula | C9H20NNa |
| Molecular Weight | 165.26 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | sodium;hydride;3,3,4,4-tetramethylcyclopentan-1-amine |
| SMILES | CC1(C)CC(N)CC1(C)C.[H-].[Na+] |
| InChI | InChI=1S/C9H19N.Na.H/c1-8(2)5-7(10)6-9(8,3)4;;/h7H,5-6,10H2,1-4H3;;/q;+1;-1 |
| InChIKey | SJIYRPGDHYWFNO-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.26 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |