C7H15ClN2 — CID 173275479
1,2-diethyl-4,5-dihydroimidazole;hydrochloride (PubChem CID 173275479) has the molecular formula C7H15ClN2 and a molecular weight of 162.66 g/mol. Its IUPAC name is 1,2-diethyl-4,5-dihydroimidazole;hydrochloride.
| Compound Name | 1,2-diethyl-4,5-dihydroimidazole;hydrochloride |
|---|---|
| PubChem CID | 173275479 |
| Molecular Formula | C7H15ClN2 |
| Molecular Weight | 162.66 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 1,2-diethyl-4,5-dihydroimidazole;hydrochloride |
| SMILES | CCC1=NCCN1CC.Cl |
| InChI | InChI=1S/C7H14N2.ClH/c1-3-7-8-5-6-9(7)4-2;/h3-6H2,1-2H3;1H |
| InChIKey | YDIWPNNXBWBLED-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.66 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |