C30H33FN2 — CID 173276645
1-[4-(2-fluoropropyl)phenyl]-N-[(4-hept-6-enylphenyl)methylideneamino]-1-phenylmethanimine (PubChem CID 173276645) has the molecular formula C30H33FN2 and a molecular weight of 440.61 g/mol. Its IUPAC name is 1-[4-(2-fluoropropyl)phenyl]-N-[(4-hept-6-enylphenyl)methylideneamino]-1-phenylmethanimine.
| Compound Name | 1-[4-(2-fluoropropyl)phenyl]-N-[(4-hept-6-enylphenyl)methylideneamino]-1-phenylmethanimine |
|---|---|
| PubChem CID | 173276645 |
| Molecular Formula | C30H33FN2 |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | 1-[4-(2-fluoropropyl)phenyl]-N-[(4-hept-6-enylphenyl)methylideneamino]-1-phenylmethanimine |
| SMILES | C=CCCCCCc1ccc(C=NN=C(c2ccccc2)c2ccc(CC(C)F)cc2)cc1 |
| InChI | InChI=1S/C30H33FN2/c1-3-4-5-6-8-11-25-14-16-27(17-15-25)23-32-33-30(28-12-9-7-10-13-28)29-20-18-26(19-21-29)22-24(2)31/h3,7,9-10,12-21,23-24H,1,4-6,8,11,22H2,2H3 |
| InChIKey | LFRXGIUZAIFPTK-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|