About carbanide;1-(1H-inden-1-id-2-yl)naphthalene;zirconium(3+)
carbanide;1-(1H-inden-1-id-2-yl)naphthalene;zirconium(3+) (PubChem CID 173277586) has the molecular formula C21H19Zr
and a molecular weight of 362.61 g/mol. Its IUPAC name is carbanide;1-(1H-inden-1-id-2-yl)naphthalene;zirconium(3+).
Molecular Properties
| Compound Name | carbanide;1-(1H-inden-1-id-2-yl)naphthalene;zirconium(3+) |
| PubChem CID | 173277586 |
| Molecular Formula | C21H19Zr |
| Molecular Weight | 362.61 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | carbanide;1-(1H-inden-1-id-2-yl)naphthalene;zirconium(3+) |
| SMILES | [CH3-].[CH3-].[Zr+3].c1ccc2[cH-]c(-c3cccc4ccccc34)cc2c1 |
| InChI | InChI=1S/C19H13.2CH3.Zr/c1-2-8-16-13-17(12-15(16)7-1)19-11-5-9-14-6-3-4-10-18(14)19;;;/h1-13H;2*1H3;/q3*-1;+3 |
| InChIKey | FRFJBZAVWGKDPY-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.61 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;1-(1H-inden-1-id-2-yl)naphthalene;zirconium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;1-(1H-inden-1-id-2-yl)naphthalene;zirconium(3+)?
The IUPAC name of carbanide;1-(1H-inden-1-id-2-yl)naphthalene;zirconium(3+) (CID 173277586) is carbanide;1-(1H-inden-1-id-2-yl)naphthalene;zirconium(3+).
What is the SMILES notation for carbanide;1-(1H-inden-1-id-2-yl)naphthalene;zirconium(3+)?
The canonical SMILES for carbanide;1-(1H-inden-1-id-2-yl)naphthalene;zirconium(3+) is [CH3-].[CH3-].[Zr+3].c1ccc2[cH-]c(-c3cccc4ccccc34)cc2c1.
What is the InChIKey of carbanide;1-(1H-inden-1-id-2-yl)naphthalene;zirconium(3+)?
The InChIKey is FRFJBZAVWGKDPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13.2CH3.Zr/c1-2-8-16-13-17(12-15(16)7-1)19-11-5-9-14-6-3-4-10-18(14)19;;;/h1-13H;2*1H3;/q3*-1;+3.
What are the key properties of carbanide;1-(1H-inden-1-id-2-yl)naphthalene;zirconium(3+)?
carbanide;1-(1H-inden-1-id-2-yl)naphthalene;zirconium(3+) has a molecular weight of 362.61 g/mol, XLogP of 6.28, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;1-(1H-inden-1-id-2-yl)naphthalene;zirconium(3+) is sourced from PubChem (CID 173277586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).