About magnesium;carbanide;2-phenyl-1H-inden-1-ide
magnesium;carbanide;2-phenyl-1H-inden-1-ide (PubChem CID 141374926) has the molecular formula C16H14Mg
and a molecular weight of 230.59 g/mol. Its IUPAC name is magnesium;carbanide;2-phenyl-1H-inden-1-ide.
Molecular Properties
| Compound Name | magnesium;carbanide;2-phenyl-1H-inden-1-ide |
| PubChem CID | 141374926 |
| Molecular Formula | C16H14Mg |
| Molecular Weight | 230.59 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | magnesium;carbanide;2-phenyl-1H-inden-1-ide |
| SMILES | [CH3-].[Mg+2].c1ccc(-c2cc3ccccc3[cH-]2)cc1 |
| InChI | InChI=1S/C15H11.CH3.Mg/c1-2-6-12(7-3-1)15-10-13-8-4-5-9-14(13)11-15;;/h1-11H;1H3;/q2*-1;+2 |
| InChIKey | SXPDNRPIXFKACI-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.59 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze magnesium;carbanide;2-phenyl-1H-inden-1-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;carbanide;2-phenyl-1H-inden-1-ide?
The IUPAC name of magnesium;carbanide;2-phenyl-1H-inden-1-ide (CID 141374926) is magnesium;carbanide;2-phenyl-1H-inden-1-ide.
What is the SMILES notation for magnesium;carbanide;2-phenyl-1H-inden-1-ide?
The canonical SMILES for magnesium;carbanide;2-phenyl-1H-inden-1-ide is [CH3-].[Mg+2].c1ccc(-c2cc3ccccc3[cH-]2)cc1.
What is the InChIKey of magnesium;carbanide;2-phenyl-1H-inden-1-ide?
The InChIKey is SXPDNRPIXFKACI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11.CH3.Mg/c1-2-6-12(7-3-1)15-10-13-8-4-5-9-14(13)11-15;;/h1-11H;1H3;/q2*-1;+2.
What are the key properties of magnesium;carbanide;2-phenyl-1H-inden-1-ide?
magnesium;carbanide;2-phenyl-1H-inden-1-ide has a molecular weight of 230.59 g/mol, XLogP of 4.30, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;carbanide;2-phenyl-1H-inden-1-ide is sourced from PubChem (CID 141374926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).