C26H28F2Zr — CID 154603989
difluorozirconium(2+);5-ethyl-1,2,3,4-tetramethylcyclopenta-1,3-diene;2-phenyl-1H-inden-1-ide (PubChem CID 154603989) has the molecular formula C26H28F2Zr and a molecular weight of 469.73 g/mol. Its IUPAC name is difluorozirconium(2+);5-ethyl-1,2,3,4-tetramethylcyclopenta-1,3-diene;2-phenyl-1H-inden-1-ide.
| Compound Name | difluorozirconium(2+);5-ethyl-1,2,3,4-tetramethylcyclopenta-1,3-diene;2-phenyl-1H-inden-1-ide |
|---|---|
| PubChem CID | 154603989 |
| Molecular Formula | C26H28F2Zr |
| Molecular Weight | 469.73 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | difluorozirconium(2+);5-ethyl-1,2,3,4-tetramethylcyclopenta-1,3-diene;2-phenyl-1H-inden-1-ide |
| SMILES | CC[c-]1c(C)c(C)c(C)c1C.F[Zr+2]F.c1ccc(-c2cc3ccccc3[cH-]2)cc1 |
| InChI | InChI=1S/C15H11.C11H17.2FH.Zr/c1-2-6-12(7-3-1)15-10-13-8-4-5-9-14(13)11-15;1-6-11-9(4)7(2)8(3)10(11)5;;;/h1-11H;6H2,1-5H3;2*1H;/q2*-1;;;+4/p-2 |
| InChIKey | ARIQCUYDRZBFRW-UHFFFAOYSA-L |
| XLogP | 8.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.73 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|