C23H30F2Zr — CID 154603971
difluorozirconium(2+);5-ethyl-1,2,3,4-tetramethylcyclopenta-1,3-diene;2,4,7-trimethyl-1H-inden-1-ide (PubChem CID 154603971) has the molecular formula C23H30F2Zr and a molecular weight of 435.71 g/mol. Its IUPAC name is difluorozirconium(2+);5-ethyl-1,2,3,4-tetramethylcyclopenta-1,3-diene;2,4,7-trimethyl-1H-inden-1-ide.
| Compound Name | difluorozirconium(2+);5-ethyl-1,2,3,4-tetramethylcyclopenta-1,3-diene;2,4,7-trimethyl-1H-inden-1-ide |
|---|---|
| PubChem CID | 154603971 |
| Molecular Formula | C23H30F2Zr |
| Molecular Weight | 435.71 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | difluorozirconium(2+);5-ethyl-1,2,3,4-tetramethylcyclopenta-1,3-diene;2,4,7-trimethyl-1H-inden-1-ide |
| SMILES | CC[c-]1c(C)c(C)c(C)c1C.Cc1cc2c(C)ccc(C)c2[cH-]1.F[Zr+2]F |
| InChI | InChI=1S/C12H13.C11H17.2FH.Zr/c1-8-6-11-9(2)4-5-10(3)12(11)7-8;1-6-11-9(4)7(2)8(3)10(11)5;;;/h4-7H,1-3H3;6H2,1-5H3;2*1H;/q2*-1;;;+4/p-2 |
| InChIKey | AKRMKUTYHGKNDN-UHFFFAOYSA-L |
| XLogP | 7.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.71 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|