C25H27Co- — CID 633568
anthracene;cobalt;5-ethyl-1,2,3,4-tetramethylcyclopenta-1,3-diene (PubChem CID 633568) has the molecular formula C25H27Co- and a molecular weight of 386.42 g/mol. Its IUPAC name is anthracene;cobalt;5-ethyl-1,2,3,4-tetramethylcyclopenta-1,3-diene.
| Compound Name | anthracene;cobalt;5-ethyl-1,2,3,4-tetramethylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 633568 |
| Molecular Formula | C25H27Co- |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | anthracene;cobalt;5-ethyl-1,2,3,4-tetramethylcyclopenta-1,3-diene |
| SMILES | CC[c-]1c(C)c(C)c(C)c1C.[Co].c1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C14H10.C11H17.Co/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;1-6-11-9(4)7(2)8(3)10(11)5;/h1-10H;6H2,1-5H3;/q;-1; |
| InChIKey | BFTMQXOKKIQQEK-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|