About ethylidenezirconium(2+);bis(2-phenyl-1H-inden-1-ide)
ethylidenezirconium(2+);bis(2-phenyl-1H-inden-1-ide) (PubChem CID 173282953) has the molecular formula C32H26Zr
and a molecular weight of 501.78 g/mol. Its IUPAC name is ethylidenezirconium(2+);bis(2-phenyl-1H-inden-1-ide).
Molecular Properties
| Compound Name | ethylidenezirconium(2+);bis(2-phenyl-1H-inden-1-ide) |
| PubChem CID | 173282953 |
| Molecular Formula | C32H26Zr |
| Molecular Weight | 501.78 g/mol |
| Exact Mass | 500.11 |
| IUPAC Name | ethylidenezirconium(2+);bis(2-phenyl-1H-inden-1-ide) |
| SMILES | CC=[Zr+2].c1ccc(-c2cc3ccccc3[cH-]2)cc1.c1ccc(-c2cc3ccccc3[cH-]2)cc1 |
| InChI | InChI=1S/2C15H11.C2H4.Zr/c2*1-2-6-12(7-3-1)15-10-13-8-4-5-9-14(13)11-15;1-2;/h2*1-11H;1H,2H3;/q2*-1;;+2 |
| InChIKey | UVELDAMPANADQX-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 501.78 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze ethylidenezirconium(2+);bis(2-phenyl-1H-inden-1-ide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylidenezirconium(2+);bis(2-phenyl-1H-inden-1-ide)?
The IUPAC name of ethylidenezirconium(2+);bis(2-phenyl-1H-inden-1-ide) (CID 173282953) is ethylidenezirconium(2+);bis(2-phenyl-1H-inden-1-ide).
What is the SMILES notation for ethylidenezirconium(2+);bis(2-phenyl-1H-inden-1-ide)?
The canonical SMILES for ethylidenezirconium(2+);bis(2-phenyl-1H-inden-1-ide) is CC=[Zr+2].c1ccc(-c2cc3ccccc3[cH-]2)cc1.c1ccc(-c2cc3ccccc3[cH-]2)cc1.
What is the InChIKey of ethylidenezirconium(2+);bis(2-phenyl-1H-inden-1-ide)?
The InChIKey is UVELDAMPANADQX-UHFFFAOYSA-N. The full InChI is InChI=1S/2C15H11.C2H4.Zr/c2*1-2-6-12(7-3-1)15-10-13-8-4-5-9-14(13)11-15;1-2;/h2*1-11H;1H,2H3;/q2*-1;;+2.
What are the key properties of ethylidenezirconium(2+);bis(2-phenyl-1H-inden-1-ide)?
ethylidenezirconium(2+);bis(2-phenyl-1H-inden-1-ide) has a molecular weight of 501.78 g/mol, XLogP of 8.81, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethylidenezirconium(2+);bis(2-phenyl-1H-inden-1-ide) is sourced from PubChem (CID 173282953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).