C23H15ClF3N5O4S — CID 173278557
N-[6-chloro-5-(2-methoxyphenoxy)-2-pyrimidin-2-ylpyrimidin-4-yl]-2-(2,3,4-trifluorophenyl)ethenesulfonamide (PubChem CID 173278557) has the molecular formula C23H15ClF3N5O4S and a molecular weight of 549.92 g/mol. Its IUPAC name is N-[6-chloro-5-(2-methoxyphenoxy)-2-pyrimidin-2-ylpyrimidin-4-yl]-2-(2,3,4-trifluorophenyl)ethenesulfonamide.
| Compound Name | N-[6-chloro-5-(2-methoxyphenoxy)-2-pyrimidin-2-ylpyrimidin-4-yl]-2-(2,3,4-trifluorophenyl)ethenesulfonamide |
|---|---|
| PubChem CID | 173278557 |
| Molecular Formula | C23H15ClF3N5O4S |
| Molecular Weight | 549.92 g/mol |
| Exact Mass | 549.05 |
| IUPAC Name | N-[6-chloro-5-(2-methoxyphenoxy)-2-pyrimidin-2-ylpyrimidin-4-yl]-2-(2,3,4-trifluorophenyl)ethenesulfonamide |
| SMILES | COc1ccccc1Oc1c(Cl)nc(-c2ncccn2)nc1NS(=O)(=O)C=Cc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C23H15ClF3N5O4S/c1-35-15-5-2-3-6-16(15)36-19-20(24)30-23(22-28-10-4-11-29-22)31-21(19)32-37(33,34)12-9-13-7-8-14(25)18(27)17(13)26/h2-12H,1H3,(H,30,31,32) |
| InChIKey | LPUYVVCYETVATN-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 116.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.92 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|