C22H19ClN6O4S — CID 21041380
N-(benzylsulfamoyl)-6-chloro-5-(2-methoxyphenoxy)-2-pyrimidin-2-ylpyrimidin-4-amine (PubChem CID 21041380) has the molecular formula C22H19ClN6O4S and a molecular weight of 498.95 g/mol. Its IUPAC name is N-(benzylsulfamoyl)-6-chloro-5-(2-methoxyphenoxy)-2-pyrimidin-2-ylpyrimidin-4-amine.
| Compound Name | N-(benzylsulfamoyl)-6-chloro-5-(2-methoxyphenoxy)-2-pyrimidin-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 21041380 |
| Molecular Formula | C22H19ClN6O4S |
| Molecular Weight | 498.95 g/mol |
| Exact Mass | 498.09 |
| IUPAC Name | N-(benzylsulfamoyl)-6-chloro-5-(2-methoxyphenoxy)-2-pyrimidin-2-ylpyrimidin-4-amine |
| SMILES | COc1ccccc1Oc1c(Cl)nc(-c2ncccn2)nc1NS(=O)(=O)NCc1ccccc1 |
| InChI | InChI=1S/C22H19ClN6O4S/c1-32-16-10-5-6-11-17(16)33-18-19(23)27-22(21-24-12-7-13-25-21)28-20(18)29-34(30,31)26-14-15-8-3-2-4-9-15/h2-13,26H,14H2,1H3,(H,27,28,29) |
| InChIKey | VQNVNVBWDQTDIA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 128.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.95 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |