C19H22N6O6S — CID 71499827
2-[6-(ethylsulfamoylamino)-5-(2-methoxyphenoxy)-2-pyrimidin-2-ylpyrimidin-4-yl]oxyethanol (PubChem CID 71499827) has the molecular formula C19H22N6O6S and a molecular weight of 462.49 g/mol. Its IUPAC name is 2-[6-(ethylsulfamoylamino)-5-(2-methoxyphenoxy)-2-pyrimidin-2-ylpyrimidin-4-yl]oxyethanol.
| Compound Name | 2-[6-(ethylsulfamoylamino)-5-(2-methoxyphenoxy)-2-pyrimidin-2-ylpyrimidin-4-yl]oxyethanol |
|---|---|
| PubChem CID | 71499827 |
| Molecular Formula | C19H22N6O6S |
| Molecular Weight | 462.49 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | 2-[6-(ethylsulfamoylamino)-5-(2-methoxyphenoxy)-2-pyrimidin-2-ylpyrimidin-4-yl]oxyethanol |
| SMILES | CCNS(=O)(=O)Nc1nc(-c2ncccn2)nc(OCCO)c1Oc1ccccc1OC |
| InChI | InChI=1S/C19H22N6O6S/c1-3-22-32(27,28)25-16-15(31-14-8-5-4-7-13(14)29-2)19(30-12-11-26)24-18(23-16)17-20-9-6-10-21-17/h4-10,22,26H,3,11-12H2,1-2H3,(H,23,24,25) |
| InChIKey | MZUDIIVPASAHPN-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 157.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.49 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |