C29H31N5O7S — CID 18327376
4-[6-[(4-tert-butylphenyl)sulfonylamino]-5-(2-methoxyphenoxy)-2-pyrimidin-2-ylpyrimidin-4-yl]oxybutanoic acid (PubChem CID 18327376) has the molecular formula C29H31N5O7S and a molecular weight of 593.66 g/mol. Its IUPAC name is 4-[6-[(4-tert-butylphenyl)sulfonylamino]-5-(2-methoxyphenoxy)-2-pyrimidin-2-ylpyrimidin-4-yl]oxybutanoic acid.
| Compound Name | 4-[6-[(4-tert-butylphenyl)sulfonylamino]-5-(2-methoxyphenoxy)-2-pyrimidin-2-ylpyrimidin-4-yl]oxybutanoic acid |
|---|---|
| PubChem CID | 18327376 |
| Molecular Formula | C29H31N5O7S |
| Molecular Weight | 593.66 g/mol |
| Exact Mass | 593.19 |
| IUPAC Name | 4-[6-[(4-tert-butylphenyl)sulfonylamino]-5-(2-methoxyphenoxy)-2-pyrimidin-2-ylpyrimidin-4-yl]oxybutanoic acid |
| SMILES | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(-c2ncccn2)nc1OCCCC(=O)O |
| InChI | InChI=1S/C29H31N5O7S/c1-29(2,3)19-12-14-20(15-13-19)42(37,38)34-25-24(41-22-10-6-5-9-21(22)39-4)28(40-18-7-11-23(35)36)33-27(32-25)26-30-16-8-17-31-26/h5-6,8-10,12-17H,7,11,18H2,1-4H3,(H,35,36)(H,32,33,34) |
| InChIKey | PGRXUPWJTZVRSL-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 162.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.66 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|