C32H38N6O10S — CID 70639342
2-[6-[(4-tert-butylphenyl)sulfonylamino]-5-(2-methoxyphenoxy)-2-pyrimidin-2-ylpyrimidin-4-yl]oxyethyl 5-(dihydroxyamino)oxypentanoate (PubChem CID 70639342) has the molecular formula C32H38N6O10S and a molecular weight of 698.76 g/mol. Its IUPAC name is 2-[6-[(4-tert-butylphenyl)sulfonylamino]-5-(2-methoxyphenoxy)-2-pyrimidin-2-ylpyrimidin-4-yl]oxyethyl 5-(dihydroxyamino)oxypentanoate.
| Compound Name | 2-[6-[(4-tert-butylphenyl)sulfonylamino]-5-(2-methoxyphenoxy)-2-pyrimidin-2-ylpyrimidin-4-yl]oxyethyl 5-(dihydroxyamino)oxypentanoate |
|---|---|
| PubChem CID | 70639342 |
| Molecular Formula | C32H38N6O10S |
| Molecular Weight | 698.76 g/mol |
| Exact Mass | 698.24 |
| IUPAC Name | 2-[6-[(4-tert-butylphenyl)sulfonylamino]-5-(2-methoxyphenoxy)-2-pyrimidin-2-ylpyrimidin-4-yl]oxyethyl 5-(dihydroxyamino)oxypentanoate |
| SMILES | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(-c2ncccn2)nc1OCCOC(=O)CCCCON(O)O |
| InChI | InChI=1S/C32H38N6O10S/c1-32(2,3)22-13-15-23(16-14-22)49(42,43)37-28-27(48-25-11-6-5-10-24(25)44-4)31(36-30(35-28)29-33-17-9-18-34-29)46-21-20-45-26(39)12-7-8-19-47-38(40)41/h5-6,9-11,13-18,40-41H,7-8,12,19-21H2,1-4H3,(H,35,36,37) |
| InChIKey | UXUDGSWXNHNXPU-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 204.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.76 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|