C33H33N7O7S — CID 54554341
2-[6-[(4-tert-butylphenyl)sulfonylamino]-5-(2-methoxyphenoxy)-2-pyrimidin-2-ylpyrimidin-4-yl]oxyethyl N-pyridin-4-ylcarbamate (PubChem CID 54554341) has the molecular formula C33H33N7O7S and a molecular weight of 671.74 g/mol. Its IUPAC name is 2-[6-[(4-tert-butylphenyl)sulfonylamino]-5-(2-methoxyphenoxy)-2-pyrimidin-2-ylpyrimidin-4-yl]oxyethyl N-pyridin-4-ylcarbamate.
| Compound Name | 2-[6-[(4-tert-butylphenyl)sulfonylamino]-5-(2-methoxyphenoxy)-2-pyrimidin-2-ylpyrimidin-4-yl]oxyethyl N-pyridin-4-ylcarbamate |
|---|---|
| PubChem CID | 54554341 |
| Molecular Formula | C33H33N7O7S |
| Molecular Weight | 671.74 g/mol |
| Exact Mass | 671.22 |
| IUPAC Name | 2-[6-[(4-tert-butylphenyl)sulfonylamino]-5-(2-methoxyphenoxy)-2-pyrimidin-2-ylpyrimidin-4-yl]oxyethyl N-pyridin-4-ylcarbamate |
| SMILES | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(-c2ncccn2)nc1OCCOC(=O)Nc1ccncc1 |
| InChI | InChI=1S/C33H33N7O7S/c1-33(2,3)22-10-12-24(13-11-22)48(42,43)40-28-27(47-26-9-6-5-8-25(26)44-4)31(39-30(38-28)29-35-16-7-17-36-29)45-20-21-46-32(41)37-23-14-18-34-19-15-23/h5-19H,20-21H2,1-4H3,(H,34,37,41)(H,38,39,40) |
| InChIKey | ZMCLOSRNDCZJCH-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 176.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.74 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|