C35H34N6O10S — CID 25093912
2-[6-[(4-tert-butylphenyl)sulfonylamino]-5-(2-methoxyphenoxy)-2-pyrimidin-2-ylpyrimidin-4-yl]oxyethyl 4-(nitrooxymethyl)benzoate (PubChem CID 25093912) has the molecular formula C35H34N6O10S and a molecular weight of 730.76 g/mol. Its IUPAC name is 2-[6-[(4-tert-butylphenyl)sulfonylamino]-5-(2-methoxyphenoxy)-2-pyrimidin-2-ylpyrimidin-4-yl]oxyethyl 4-(nitrooxymethyl)benzoate.
| Compound Name | 2-[6-[(4-tert-butylphenyl)sulfonylamino]-5-(2-methoxyphenoxy)-2-pyrimidin-2-ylpyrimidin-4-yl]oxyethyl 4-(nitrooxymethyl)benzoate |
|---|---|
| PubChem CID | 25093912 |
| Molecular Formula | C35H34N6O10S |
| Molecular Weight | 730.76 g/mol |
| Exact Mass | 730.21 |
| IUPAC Name | 2-[6-[(4-tert-butylphenyl)sulfonylamino]-5-(2-methoxyphenoxy)-2-pyrimidin-2-ylpyrimidin-4-yl]oxyethyl 4-(nitrooxymethyl)benzoate |
| SMILES | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(-c2ncccn2)nc1OCCOC(=O)c1ccc(CO[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C35H34N6O10S/c1-35(2,3)25-14-16-26(17-15-25)52(45,46)40-30-29(51-28-9-6-5-8-27(28)47-4)33(39-32(38-30)31-36-18-7-19-37-31)48-20-21-49-34(42)24-12-10-23(11-13-24)22-50-41(43)44/h5-19H,20-22H2,1-4H3,(H,38,39,40) |
| InChIKey | UETJMZHXZXOVRF-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 204.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.76 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|