C27H29KN5O6S — CID 66744754
Bosentan potassium (PubChem CID 66744754) has the molecular formula C27H29KN5O6S and a molecular weight of 590.72 g/mol.
| Compound Name | Bosentan potassium |
|---|---|
| PubChem CID | 66744754 |
| Molecular Formula | C27H29KN5O6S |
| Molecular Weight | 590.72 g/mol |
| Exact Mass | 590.15 |
| IUPAC Name | — |
| SMILES | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(-c2ncccn2)nc1OCCO.[K] |
| InChI | InChI=1S/C27H29N5O6S.K/c1-27(2,3)18-10-12-19(13-11-18)39(34,35)32-23-22(38-21-9-6-5-8-20(21)36-4)26(37-17-16-33)31-25(30-23)24-28-14-7-15-29-24;/h5-15,33H,16-17H2,1-4H3,(H,30,31,32); |
| InChIKey | HMTVBUNRGIIXSG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 145.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.72 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |