About boranuide;tributyl(cyclohexyl)phosphanium
boranuide;tributyl(cyclohexyl)phosphanium (PubChem CID 173280265) has the molecular formula C18H42BP
and a molecular weight of 300.32 g/mol. Its IUPAC name is boranuide;tributyl(cyclohexyl)phosphanium.
Molecular Properties
| Compound Name | boranuide;tributyl(cyclohexyl)phosphanium |
| PubChem CID | 173280265 |
| Molecular Formula | C18H42BP |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.31 |
| IUPAC Name | boranuide;tributyl(cyclohexyl)phosphanium |
| SMILES | CCCC[P+](CCCC)(CCCC)C1CCCCC1.[BH4-] |
| InChI | InChI=1S/C18H38P.BH4/c1-4-7-15-19(16-8-5-2,17-9-6-3)18-13-11-10-12-14-18;/h18H,4-17H2,1-3H3;1H4/q+1;-1 |
| InChIKey | BSUSXEUDEQKHFV-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze boranuide;tributyl(cyclohexyl)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of boranuide;tributyl(cyclohexyl)phosphanium?
The IUPAC name of boranuide;tributyl(cyclohexyl)phosphanium (CID 173280265) is boranuide;tributyl(cyclohexyl)phosphanium.
What is the SMILES notation for boranuide;tributyl(cyclohexyl)phosphanium?
The canonical SMILES for boranuide;tributyl(cyclohexyl)phosphanium is CCCC[P+](CCCC)(CCCC)C1CCCCC1.[BH4-].
What is the InChIKey of boranuide;tributyl(cyclohexyl)phosphanium?
The InChIKey is BSUSXEUDEQKHFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H38P.BH4/c1-4-7-15-19(16-8-5-2,17-9-6-3)18-13-11-10-12-14-18;/h18H,4-17H2,1-3H3;1H4/q+1;-1.
What are the key properties of boranuide;tributyl(cyclohexyl)phosphanium?
boranuide;tributyl(cyclohexyl)phosphanium has a molecular weight of 300.32 g/mol, XLogP of 5.29, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for boranuide;tributyl(cyclohexyl)phosphanium is sourced from PubChem (CID 173280265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).