C25H50N2O6 — CID 173281200
(1-oxo-1-pentoxyheptan-2-yl)carbamic acid;pentyl 2-aminoheptanoate (PubChem CID 173281200) has the molecular formula C25H50N2O6 and a molecular weight of 474.68 g/mol. Its IUPAC name is (1-oxo-1-pentoxyheptan-2-yl)carbamic acid;pentyl 2-aminoheptanoate.
| Compound Name | (1-oxo-1-pentoxyheptan-2-yl)carbamic acid;pentyl 2-aminoheptanoate |
|---|---|
| PubChem CID | 173281200 |
| Molecular Formula | C25H50N2O6 |
| Molecular Weight | 474.68 g/mol |
| Exact Mass | 474.37 |
| IUPAC Name | (1-oxo-1-pentoxyheptan-2-yl)carbamic acid;pentyl 2-aminoheptanoate |
| SMILES | CCCCCOC(=O)C(CCCCC)NC(=O)O.CCCCCOC(=O)C(N)CCCCC |
| InChI | InChI=1S/C13H25NO4.C12H25NO2/c1-3-5-7-9-11(14-13(16)17)12(15)18-10-8-6-4-2;1-3-5-7-9-11(13)12(14)15-10-8-6-4-2/h11,14H,3-10H2,1-2H3,(H,16,17);11H,3-10,13H2,1-2H3 |
| InChIKey | VUNHXVUGXYZQNQ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.68 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|